C27H35N3O9 — CID 162506278
CID 162506278 (PubChem CID 162506278) has the molecular formula C27H35N3O9 and a molecular weight of 545.59 g/mol.
| Compound Name | CID 162506278 |
|---|---|
| PubChem CID | 162506278 |
| Molecular Formula | C27H35N3O9 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(O)=C(C(N)=O)C4(OCCO4)[C@@]3(O)C(O)=C1C21OCCO1 |
| InChI | InChI=1S/C27H35N3O9/c1-29(2)16-5-6-17(31)19-14(16)11-13-12-15-21(30(3)4)22(32)20(24(28)34)27(38-9-10-39-27)25(15,35)23(33)18(13)26(19)36-7-8-37-26/h5-6,13,15,21,31-33,35H,7-12H2,1-4H3,(H2,28,34)/t13-,15-,21-,25-/m0/s1 |
| InChIKey | KTPJNRCMHLYWDZ-JOZUSPFHSA-N |
| XLogP | 0.38 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |