About 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine
6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine (PubChem CID 162507567) has the molecular formula C19H15FN4O2
and a molecular weight of 350.35 g/mol. Its IUPAC name is 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine |
| PubChem CID | 162507567 |
| Molecular Formula | C19H15FN4O2 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine |
| SMILES | COCc1cn2cc(-c3cnc(Oc4cccc(F)c4)nc3)ccc2n1 |
| InChI | InChI=1S/C19H15FN4O2/c1-25-12-16-11-24-10-13(5-6-18(24)23-16)14-8-21-19(22-9-14)26-17-4-2-3-15(20)7-17/h2-11H,12H2,1H3 |
| InChIKey | CUHHFFHAUDGTAJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine?
The IUPAC name of 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine (CID 162507567) is 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine.
What is the SMILES notation for 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine?
The canonical SMILES for 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine is COCc1cn2cc(-c3cnc(Oc4cccc(F)c4)nc3)ccc2n1.
What is the InChIKey of 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine?
The InChIKey is CUHHFFHAUDGTAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN4O2/c1-25-12-16-11-24-10-13(5-6-18(24)23-16)14-8-21-19(22-9-14)26-17-4-2-3-15(20)7-17/h2-11H,12H2,1H3.
What are the key properties of 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine?
6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine has a molecular weight of 350.35 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3-fluorophenoxy)pyrimidin-5-yl]-2-(methoxymethyl)imidazo[1,2-a]pyridine is sourced from PubChem (CID 162507567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).