About 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate
2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate (PubChem CID 162509507) has the molecular formula C10H19INO2+
and a molecular weight of 312.17 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate.
Molecular Properties
| Compound Name | 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate |
| PubChem CID | 162509507 |
| Molecular Formula | C10H19INO2+ |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate |
| SMILES | CC(I)C(=O)OCCC1CCC[NH+]1C |
| InChI | InChI=1S/C10H18INO2/c1-8(11)10(13)14-7-5-9-4-3-6-12(9)2/h8-9H,3-7H2,1-2H3/p+1 |
| InChIKey | GOLLYEDYDXEPBZ-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate?
The IUPAC name of 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate (CID 162509507) is 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate.
What is the SMILES notation for 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate?
The canonical SMILES for 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate is CC(I)C(=O)OCCC1CCC[NH+]1C.
What is the InChIKey of 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate?
The InChIKey is GOLLYEDYDXEPBZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H18INO2/c1-8(11)10(13)14-7-5-9-4-3-6-12(9)2/h8-9H,3-7H2,1-2H3/p+1.
What are the key properties of 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate?
2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate has a molecular weight of 312.17 g/mol, XLogP of 0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpyrrolidin-1-ium-2-yl)ethyl 2-iodopropanoate is sourced from PubChem (CID 162509507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).