C17H15F5N2O3 — CID 162511682
1-[2-(dimethylamino)phenyl]-2,2,3,3,3-pentafluoro-1-(2-nitrophenyl)propan-1-ol (PubChem CID 162511682) has the molecular formula C17H15F5N2O3 and a molecular weight of 390.31 g/mol. Its IUPAC name is 1-[2-(dimethylamino)phenyl]-2,2,3,3,3-pentafluoro-1-(2-nitrophenyl)propan-1-ol.
| Compound Name | 1-[2-(dimethylamino)phenyl]-2,2,3,3,3-pentafluoro-1-(2-nitrophenyl)propan-1-ol |
|---|---|
| PubChem CID | 162511682 |
| Molecular Formula | C17H15F5N2O3 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1-[2-(dimethylamino)phenyl]-2,2,3,3,3-pentafluoro-1-(2-nitrophenyl)propan-1-ol |
| SMILES | CN(C)c1ccccc1C(O)(c1ccccc1[N+](=O)[O-])C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H15F5N2O3/c1-23(2)13-9-5-3-7-11(13)15(25,16(18,19)17(20,21)22)12-8-4-6-10-14(12)24(26)27/h3-10,25H,1-2H3 |
| InChIKey | STLHJSSDLALFRP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|