C32H34FN7O2 — CID 162512848
N-[5-[[4-[2-(4-fluorophenyl)imidazol-1-yl]-2-pyridinyl]amino]-2-(4-morpholin-4-ylpiperidin-1-yl)phenyl]prop-2-enamide (PubChem CID 162512848) has the molecular formula C32H34FN7O2 and a molecular weight of 567.67 g/mol. Its IUPAC name is N-[5-[[4-[2-(4-fluorophenyl)imidazol-1-yl]-2-pyridinyl]amino]-2-(4-morpholin-4-ylpiperidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | N-[5-[[4-[2-(4-fluorophenyl)imidazol-1-yl]-2-pyridinyl]amino]-2-(4-morpholin-4-ylpiperidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162512848 |
| Molecular Formula | C32H34FN7O2 |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | N-[5-[[4-[2-(4-fluorophenyl)imidazol-1-yl]-2-pyridinyl]amino]-2-(4-morpholin-4-ylpiperidin-1-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2cc(-n3ccnc3-c3ccc(F)cc3)ccn2)ccc1N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C32H34FN7O2/c1-2-31(41)37-28-21-25(7-8-29(28)39-14-10-26(11-15-39)38-17-19-42-20-18-38)36-30-22-27(9-12-34-30)40-16-13-35-32(40)23-3-5-24(33)6-4-23/h2-9,12-13,16,21-22,26H,1,10-11,14-15,17-20H2,(H,34,36)(H,37,41) |
| InChIKey | YCZJZDWSRCDZEM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|