C9H12ClF2N3O — CID 162514057
2-[[5-chloro-6-(difluoromethyl)-2-methylpyrimidin-4-yl]amino]propan-1-ol (PubChem CID 162514057) has the molecular formula C9H12ClF2N3O and a molecular weight of 251.66 g/mol. Its IUPAC name is 2-[[5-chloro-6-(difluoromethyl)-2-methylpyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 2-[[5-chloro-6-(difluoromethyl)-2-methylpyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 162514057 |
| Molecular Formula | C9H12ClF2N3O |
| Molecular Weight | 251.66 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-[[5-chloro-6-(difluoromethyl)-2-methylpyrimidin-4-yl]amino]propan-1-ol |
| SMILES | Cc1nc(NC(C)CO)c(Cl)c(C(F)F)n1 |
| InChI | InChI=1S/C9H12ClF2N3O/c1-4(3-16)13-9-6(10)7(8(11)12)14-5(2)15-9/h4,8,16H,3H2,1-2H3,(H,13,14,15) |
| InChIKey | UXOAJKNQDVSBHU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.66 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |