C24H28O6 — CID 162515113
methyl 1,2,6,7-tetraethoxyphenanthrene-9-carboxylate (PubChem CID 162515113) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is methyl 1,2,6,7-tetraethoxyphenanthrene-9-carboxylate.
| Compound Name | methyl 1,2,6,7-tetraethoxyphenanthrene-9-carboxylate |
|---|---|
| PubChem CID | 162515113 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | methyl 1,2,6,7-tetraethoxyphenanthrene-9-carboxylate |
| SMILES | CCOc1cc2c(C(=O)OC)cc3c(OCC)c(OCC)ccc3c2cc1OCC |
| InChI | InChI=1S/C24H28O6/c1-6-27-20-11-10-15-16-13-21(28-7-2)22(29-8-3)14-17(16)19(24(25)26-5)12-18(15)23(20)30-9-4/h10-14H,6-9H2,1-5H3 |
| InChIKey | CQNUCDKBLSJCRA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|