methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate

C24H28O5 — CID 118485785

IUPACmethyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate
SMILESCCCCOc1ccc2cc(C(=O)OC)c3cc(OCC)c(OCC)cc3c2c1
InChIInChI=1S/C24H28O5/c1-5-8-11-29-17-10-9-16-12-21(24(25)26-4)20-15-23(28-7-3)22(27-6-2)14-19(20)18(16)13-17/h9-10,12-15H,5-8,11H2,1-4H3
InChIKeyOTCKYTBCTDEQSJ-UHFFFAOYSA-N
MW396.48 g/mol
LogP5.76
Rot. Bonds9

About methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate

methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate (PubChem CID 118485785) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate.

Molecular Properties

Compound Namemethyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate
PubChem CID118485785
Molecular FormulaC24H28O5
Molecular Weight396.48 g/mol
Exact Mass396.19
IUPAC Namemethyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate
SMILESCCCCOc1ccc2cc(C(=O)OC)c3cc(OCC)c(OCC)cc3c2c1
InChIInChI=1S/C24H28O5/c1-5-8-11-29-17-10-9-16-12-21(24(25)26-4)20-15-23(28-7-3)22(27-6-2)14-19(20)18(16)13-17/h9-10,12-15H,5-8,11H2,1-4H3
InChIKeyOTCKYTBCTDEQSJ-UHFFFAOYSA-N
XLogP5.76
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500396.48
LogP ≤ 55.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate?
The IUPAC name of methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate (CID 118485785) is methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate.
What is the SMILES notation for methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate?
The canonical SMILES for methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate is CCCCOc1ccc2cc(C(=O)OC)c3cc(OCC)c(OCC)cc3c2c1.
What is the InChIKey of methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate?
The InChIKey is OTCKYTBCTDEQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O5/c1-5-8-11-29-17-10-9-16-12-21(24(25)26-4)20-15-23(28-7-3)22(27-6-2)14-19(20)18(16)13-17/h9-10,12-15H,5-8,11H2,1-4H3.
What are the key properties of methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate?
methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate has a molecular weight of 396.48 g/mol, XLogP of 5.76, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate is sourced from PubChem (CID 118485785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).