C24H28O5 — CID 118485785
methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate (PubChem CID 118485785) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate.
| Compound Name | methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate |
|---|---|
| PubChem CID | 118485785 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | methyl 3-butoxy-6,7-diethoxyphenanthrene-9-carboxylate |
| SMILES | CCCCOc1ccc2cc(C(=O)OC)c3cc(OCC)c(OCC)cc3c2c1 |
| InChI | InChI=1S/C24H28O5/c1-5-8-11-29-17-10-9-16-12-21(24(25)26-4)20-15-23(28-7-3)22(27-6-2)14-19(20)18(16)13-17/h9-10,12-15H,5-8,11H2,1-4H3 |
| InChIKey | OTCKYTBCTDEQSJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|