methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate

C23H26O4 — CID 162515122

IUPACmethyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate
SMILESCCCOc1cc2cc(C(=O)OC)c3ccc(C)cc3c2cc1OCCC
InChIInChI=1S/C23H26O4/c1-5-9-26-21-13-16-12-20(23(24)25-4)17-8-7-15(3)11-19(17)18(16)14-22(21)27-10-6-2/h7-8,11-14H,5-6,9-10H2,1-4H3
InChIKeyYWUUFXFYDAAOPZ-UHFFFAOYSA-N
MW366.46 g/mol
LogP5.67
Rot. Bonds7

About methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate

methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate (PubChem CID 162515122) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate.

Molecular Properties

Compound Namemethyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate
PubChem CID162515122
Molecular FormulaC23H26O4
Molecular Weight366.46 g/mol
Exact Mass366.18
IUPAC Namemethyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate
SMILESCCCOc1cc2cc(C(=O)OC)c3ccc(C)cc3c2cc1OCCC
InChIInChI=1S/C23H26O4/c1-5-9-26-21-13-16-12-20(23(24)25-4)17-8-7-15(3)11-19(17)18(16)14-22(21)27-10-6-2/h7-8,11-14H,5-6,9-10H2,1-4H3
InChIKeyYWUUFXFYDAAOPZ-UHFFFAOYSA-N
XLogP5.67
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500366.46
LogP ≤ 55.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate?
The IUPAC name of methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate (CID 162515122) is methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate.
What is the SMILES notation for methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate?
The canonical SMILES for methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate is CCCOc1cc2cc(C(=O)OC)c3ccc(C)cc3c2cc1OCCC.
What is the InChIKey of methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate?
The InChIKey is YWUUFXFYDAAOPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26O4/c1-5-9-26-21-13-16-12-20(23(24)25-4)17-8-7-15(3)11-19(17)18(16)14-22(21)27-10-6-2/h7-8,11-14H,5-6,9-10H2,1-4H3.
What are the key properties of methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate?
methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate has a molecular weight of 366.46 g/mol, XLogP of 5.67, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-2,3-dipropoxyphenanthrene-9-carboxylate is sourced from PubChem (CID 162515122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).