C26H27N5O4S — CID 162515502
(2R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-(N-formyl-4-phenoxyanilino)acetyl]pyrrolidine-2-carboxamide (PubChem CID 162515502) has the molecular formula C26H27N5O4S and a molecular weight of 505.60 g/mol. Its IUPAC name is (2R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-(N-formyl-4-phenoxyanilino)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-(N-formyl-4-phenoxyanilino)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 162515502 |
| Molecular Formula | C26H27N5O4S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | (2R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-(N-formyl-4-phenoxyanilino)acetyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@H]2CCCN2C(=O)CN(C=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H27N5O4S/c27-25(28)18-13-22(36-16-18)14-29-26(34)23-7-4-12-31(23)24(33)15-30(17-32)19-8-10-21(11-9-19)35-20-5-2-1-3-6-20/h1-3,5-6,8-11,13,16-17,23H,4,7,12,14-15H2,(H3,27,28)(H,29,34)/t23-/m1/s1 |
| InChIKey | IOSBVEXSSLVWDT-HSZRJFAPSA-N |
| XLogP | 3.09 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|