C27H30N4O3S — CID 155144843
(2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[4-oxo-4-(4-phenoxyphenyl)butyl]pyrrolidine-2-carboxamide (PubChem CID 155144843) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[4-oxo-4-(4-phenoxyphenyl)butyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[4-oxo-4-(4-phenoxyphenyl)butyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155144843 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[4-oxo-4-(4-phenoxyphenyl)butyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@@H]2CCCN2CCCC(=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H30N4O3S/c28-26(29)20-16-23(35-18-20)17-30-27(33)24-8-4-14-31(24)15-5-9-25(32)19-10-12-22(13-11-19)34-21-6-2-1-3-7-21/h1-3,6-7,10-13,16,18,24H,4-5,8-9,14-15,17H2,(H3,28,29)(H,30,33)/t24-/m0/s1 |
| InChIKey | QINJUTMZZYIIDW-DEOSSOPVSA-N |
| XLogP | 4.57 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|