C14H18BFN2O — CID 162524598
CID 162524598 (PubChem CID 162524598) has the molecular formula C14H18BFN2O and a molecular weight of 260.12 g/mol.
| Compound Name | CID 162524598 |
|---|---|
| PubChem CID | 162524598 |
| Molecular Formula | C14H18BFN2O |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc2nc(C(C)CCC)c(=O)[nH]c2c1F.[H][H] |
| InChI | InChI=1S/C14H16BFN2O.H2/c1-3-4-8(2)12-14(19)18-13-10(17-12)6-5-9(7-15)11(13)16;/h5-6,8H,3-4,7H2,1-2H3,(H,18,19);1H |
| InChIKey | PIPXIAPOUTXYHS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|