C24H26F3N3OS — CID 162526244
2-[3-[2-methoxy-4-[methyl(methylidene)-λ4-sulfanyl]anilino]prop-1-ynyl]-N,N-dimethyl-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 162526244) has the molecular formula C24H26F3N3OS and a molecular weight of 461.55 g/mol. Its IUPAC name is 2-[3-[2-methoxy-4-[methyl(methylidene)-λ4-sulfanyl]anilino]prop-1-ynyl]-N,N-dimethyl-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-[2-methoxy-4-[methyl(methylidene)-λ4-sulfanyl]anilino]prop-1-ynyl]-N,N-dimethyl-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 162526244 |
| Molecular Formula | C24H26F3N3OS |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-[3-[2-methoxy-4-[methyl(methylidene)-λ4-sulfanyl]anilino]prop-1-ynyl]-N,N-dimethyl-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | C=S(C)c1ccc(NCC#Cc2cc3c(N(C)C)cccc3n2CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C24H26F3N3OS/c1-29(2)21-9-6-10-22-19(21)14-17(30(22)16-24(25,26)27)8-7-13-28-20-12-11-18(32(4)5)15-23(20)31-3/h6,9-12,14-15,28H,4,13,16H2,1-3,5H3 |
| InChIKey | JIIOIYYPFHOISA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|