C27H29ClN4O2 — CID 162526997
6-[5-chloro-8-(prop-2-enoylamino)naphthalen-2-yl]-N-[2-(1-methylpiperidin-4-yl)ethyl]pyridine-2-carboxamide (PubChem CID 162526997) has the molecular formula C27H29ClN4O2 and a molecular weight of 477.01 g/mol. Its IUPAC name is 6-[5-chloro-8-(prop-2-enoylamino)naphthalen-2-yl]-N-[2-(1-methylpiperidin-4-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 6-[5-chloro-8-(prop-2-enoylamino)naphthalen-2-yl]-N-[2-(1-methylpiperidin-4-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162526997 |
| Molecular Formula | C27H29ClN4O2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 6-[5-chloro-8-(prop-2-enoylamino)naphthalen-2-yl]-N-[2-(1-methylpiperidin-4-yl)ethyl]pyridine-2-carboxamide |
| SMILES | C=CC(=O)Nc1ccc(Cl)c2ccc(-c3cccc(C(=O)NCCC4CCN(C)CC4)n3)cc12 |
| InChI | InChI=1S/C27H29ClN4O2/c1-3-26(33)31-24-10-9-22(28)20-8-7-19(17-21(20)24)23-5-4-6-25(30-23)27(34)29-14-11-18-12-15-32(2)16-13-18/h3-10,17-18H,1,11-16H2,2H3,(H,29,34)(H,31,33) |
| InChIKey | UHADCJLRKBKWRE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|