C29H37N5O3 — CID 162527654
N,1-dimethylpiperidin-4-amine;N-[7-(6-formyl-2-pyridinyl)naphthalen-1-yl]prop-2-enamide;2-(methylamino)acetaldehyde (PubChem CID 162527654) has the molecular formula C29H37N5O3 and a molecular weight of 503.65 g/mol. Its IUPAC name is N,1-dimethylpiperidin-4-amine;N-[7-(6-formyl-2-pyridinyl)naphthalen-1-yl]prop-2-enamide;2-(methylamino)acetaldehyde.
| Compound Name | N,1-dimethylpiperidin-4-amine;N-[7-(6-formyl-2-pyridinyl)naphthalen-1-yl]prop-2-enamide;2-(methylamino)acetaldehyde |
|---|---|
| PubChem CID | 162527654 |
| Molecular Formula | C29H37N5O3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | N,1-dimethylpiperidin-4-amine;N-[7-(6-formyl-2-pyridinyl)naphthalen-1-yl]prop-2-enamide;2-(methylamino)acetaldehyde |
| SMILES | C=CC(=O)Nc1cccc2ccc(-c3cccc(C=O)n3)cc12.CNC1CCN(C)CC1.CNCC=O |
| InChI | InChI=1S/C19H14N2O2.C7H16N2.C3H7NO/c1-2-19(23)21-18-8-3-5-13-9-10-14(11-16(13)18)17-7-4-6-15(12-22)20-17;1-8-7-3-5-9(2)6-4-7;1-4-2-3-5/h2-12H,1H2,(H,21,23);7-8H,3-6H2,1-2H3;3-4H,2H2,1H3 |
| InChIKey | UKBQMEMCRFCCLX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|