C24H28ClN5O2 — CID 162528198
2-chloro-N-[7-(4-formylpyrimidin-2-yl)naphthalen-1-yl]acetamide;N,1-dimethylpiperidin-4-amine (PubChem CID 162528198) has the molecular formula C24H28ClN5O2 and a molecular weight of 453.97 g/mol. Its IUPAC name is 2-chloro-N-[7-(4-formylpyrimidin-2-yl)naphthalen-1-yl]acetamide;N,1-dimethylpiperidin-4-amine.
| Compound Name | 2-chloro-N-[7-(4-formylpyrimidin-2-yl)naphthalen-1-yl]acetamide;N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 162528198 |
| Molecular Formula | C24H28ClN5O2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-chloro-N-[7-(4-formylpyrimidin-2-yl)naphthalen-1-yl]acetamide;N,1-dimethylpiperidin-4-amine |
| SMILES | CNC1CCN(C)CC1.O=Cc1ccnc(-c2ccc3cccc(NC(=O)CCl)c3c2)n1 |
| InChI | InChI=1S/C17H12ClN3O2.C7H16N2/c18-9-16(23)21-15-3-1-2-11-4-5-12(8-14(11)15)17-19-7-6-13(10-22)20-17;1-8-7-3-5-9(2)6-4-7/h1-8,10H,9H2,(H,21,23);7-8H,3-6H2,1-2H3 |
| InChIKey | RFUQNRGNSNIZSA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|