C29H36N4O3 — CID 162526930
N-[2-ethoxy-7-(6-formyl-2-pyridinyl)naphthalen-1-yl]prop-2-enamide;N-methyl-1-(1-methylpiperidin-4-yl)methanamine (PubChem CID 162526930) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is N-[2-ethoxy-7-(6-formyl-2-pyridinyl)naphthalen-1-yl]prop-2-enamide;N-methyl-1-(1-methylpiperidin-4-yl)methanamine.
| Compound Name | N-[2-ethoxy-7-(6-formyl-2-pyridinyl)naphthalen-1-yl]prop-2-enamide;N-methyl-1-(1-methylpiperidin-4-yl)methanamine |
|---|---|
| PubChem CID | 162526930 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | N-[2-ethoxy-7-(6-formyl-2-pyridinyl)naphthalen-1-yl]prop-2-enamide;N-methyl-1-(1-methylpiperidin-4-yl)methanamine |
| SMILES | C=CC(=O)Nc1c(OCC)ccc2ccc(-c3cccc(C=O)n3)cc12.CNCC1CCN(C)CC1 |
| InChI | InChI=1S/C21H18N2O3.C8H18N2/c1-3-20(25)23-21-17-12-15(18-7-5-6-16(13-24)22-18)9-8-14(17)10-11-19(21)26-4-2;1-9-7-8-3-5-10(2)6-4-8/h3,5-13H,1,4H2,2H3,(H,23,25);8-9H,3-7H2,1-2H3 |
| InChIKey | IBPPVWJFAFOFDH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|