C28H30N6O2 — CID 162526809
6-[7-carbamoyl-8-(2-cyanoprop-2-enylamino)naphthalen-2-yl]-N-[(1-methylpiperidin-4-yl)methyl]pyridine-2-carboxamide (PubChem CID 162526809) has the molecular formula C28H30N6O2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 6-[7-carbamoyl-8-(2-cyanoprop-2-enylamino)naphthalen-2-yl]-N-[(1-methylpiperidin-4-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 6-[7-carbamoyl-8-(2-cyanoprop-2-enylamino)naphthalen-2-yl]-N-[(1-methylpiperidin-4-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162526809 |
| Molecular Formula | C28H30N6O2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 6-[7-carbamoyl-8-(2-cyanoprop-2-enylamino)naphthalen-2-yl]-N-[(1-methylpiperidin-4-yl)methyl]pyridine-2-carboxamide |
| SMILES | C=C(C#N)CNc1c(C(N)=O)ccc2ccc(-c3cccc(C(=O)NCC4CCN(C)CC4)n3)cc12 |
| InChI | InChI=1S/C28H30N6O2/c1-18(15-29)16-31-26-22(27(30)35)9-8-20-6-7-21(14-23(20)26)24-4-3-5-25(33-24)28(36)32-17-19-10-12-34(2)13-11-19/h3-9,14,19,31H,1,10-13,16-17H2,2H3,(H2,30,35)(H,32,36) |
| InChIKey | ZVQLIWGNMKKYKE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|