C23H23N5O3 — CID 162526989
4-amino-6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(2-hydroxyethyl)pyridine-2-carboxamide (PubChem CID 162526989) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 4-amino-6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(2-hydroxyethyl)pyridine-2-carboxamide.
| Compound Name | 4-amino-6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(2-hydroxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162526989 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 4-amino-6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(2-hydroxyethyl)pyridine-2-carboxamide |
| SMILES | C=C(C#N)CNc1c(OC)ccc2ccc(-c3cc(N)cc(C(=O)NCCO)n3)cc12 |
| InChI | InChI=1S/C23H23N5O3/c1-14(12-24)13-27-22-18-9-16(4-3-15(18)5-6-21(22)31-2)19-10-17(25)11-20(28-19)23(30)26-7-8-29/h3-6,9-11,27,29H,1,7-8,13H2,2H3,(H2,25,28)(H,26,30) |
| InChIKey | GQHXNEWOFZRMDO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|