C29H31N5O3 — CID 166914815
N-[(1R,3R)-3-acetamidocyclohexyl]-6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]pyridine-2-carboxamide (PubChem CID 166914815) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[(1R,3R)-3-acetamidocyclohexyl]-6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]pyridine-2-carboxamide.
| Compound Name | N-[(1R,3R)-3-acetamidocyclohexyl]-6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166914815 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | N-[(1R,3R)-3-acetamidocyclohexyl]-6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]pyridine-2-carboxamide |
| SMILES | C=C(C#N)CNc1c(OC)ccc2ccc(-c3cccc(C(=O)N[C@@H]4CCC[C@@H](NC(C)=O)C4)n3)cc12 |
| InChI | InChI=1S/C29H31N5O3/c1-18(16-30)17-31-28-24-14-21(11-10-20(24)12-13-27(28)37-3)25-8-5-9-26(34-25)29(36)33-23-7-4-6-22(15-23)32-19(2)35/h5,8-14,22-23,31H,1,4,6-7,15,17H2,2-3H3,(H,32,35)(H,33,36)/t22-,23-/m1/s1 |
| InChIKey | VPHHBMIEOKBIJK-DHIUTWEWSA-N |
| XLogP | 4.58 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|