C27H27N5O3 — CID 162527594
6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(1-methyl-2-oxopiperidin-4-yl)pyridine-2-carboxamide (PubChem CID 162527594) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(1-methyl-2-oxopiperidin-4-yl)pyridine-2-carboxamide.
| Compound Name | 6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(1-methyl-2-oxopiperidin-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162527594 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-(1-methyl-2-oxopiperidin-4-yl)pyridine-2-carboxamide |
| SMILES | C=C(C#N)CNc1c(OC)ccc2ccc(-c3cccc(C(=O)NC4CCN(C)C(=O)C4)n3)cc12 |
| InChI | InChI=1S/C27H27N5O3/c1-17(15-28)16-29-26-21-13-19(8-7-18(21)9-10-24(26)35-3)22-5-4-6-23(31-22)27(34)30-20-11-12-32(2)25(33)14-20/h4-10,13,20,29H,1,11-12,14,16H2,2-3H3,(H,30,34) |
| InChIKey | CUCVIERACBGYGD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|