C31H37N5O3 — CID 167350048
3-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-[4-(3-methoxypropylamino)cyclohexyl]pyridine-2-carboxamide (PubChem CID 167350048) has the molecular formula C31H37N5O3 and a molecular weight of 527.67 g/mol. Its IUPAC name is 3-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-[4-(3-methoxypropylamino)cyclohexyl]pyridine-2-carboxamide.
| Compound Name | 3-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-[4-(3-methoxypropylamino)cyclohexyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167350048 |
| Molecular Formula | C31H37N5O3 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 3-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-[4-(3-methoxypropylamino)cyclohexyl]pyridine-2-carboxamide |
| SMILES | C=C(C#N)CNc1c(OC)ccc2ccc(-c3cccnc3C(=O)NC3CCC(NCCCOC)CC3)cc12 |
| InChI | InChI=1S/C31H37N5O3/c1-21(19-32)20-35-29-27-18-23(8-7-22(27)9-14-28(29)39-3)26-6-4-15-34-30(26)31(37)36-25-12-10-24(11-13-25)33-16-5-17-38-2/h4,6-9,14-15,18,24-25,33,35H,1,5,10-13,16-17,20H2,2-3H3,(H,36,37) |
| InChIKey | WMTBSHPCXUFQPF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|