C25H29N5O2S — CID 162526624
2-[[[7-(5-formyl-1,3-thiazol-2-yl)-2-methoxynaphthalen-1-yl]amino]methyl]prop-2-enenitrile;1-methylpiperidin-4-amine (PubChem CID 162526624) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is 2-[[[7-(5-formyl-1,3-thiazol-2-yl)-2-methoxynaphthalen-1-yl]amino]methyl]prop-2-enenitrile;1-methylpiperidin-4-amine.
| Compound Name | 2-[[[7-(5-formyl-1,3-thiazol-2-yl)-2-methoxynaphthalen-1-yl]amino]methyl]prop-2-enenitrile;1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 162526624 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-[[[7-(5-formyl-1,3-thiazol-2-yl)-2-methoxynaphthalen-1-yl]amino]methyl]prop-2-enenitrile;1-methylpiperidin-4-amine |
| SMILES | C=C(C#N)CNc1c(OC)ccc2ccc(-c3ncc(C=O)s3)cc12.CN1CCC(N)CC1 |
| InChI | InChI=1S/C19H15N3O2S.C6H14N2/c1-12(8-20)9-21-18-16-7-14(19-22-10-15(11-23)25-19)4-3-13(16)5-6-17(18)24-2;1-8-4-2-6(7)3-5-8/h3-7,10-11,21H,1,9H2,2H3;6H,2-5,7H2,1H3 |
| InChIKey | DRHQVVOYHPMJGX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|