C25H22N6O2 — CID 162527491
N-[2-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-4-pyridinyl]-1-methylpyrazole-4-carboxamide (PubChem CID 162527491) has the molecular formula C25H22N6O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is N-[2-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-4-pyridinyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[2-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-4-pyridinyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162527491 |
| Molecular Formula | C25H22N6O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[2-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-4-pyridinyl]-1-methylpyrazole-4-carboxamide |
| SMILES | C=C(C#N)CNc1c(OC)ccc2ccc(-c3cc(NC(=O)c4cnn(C)c4)ccn3)cc12 |
| InChI | InChI=1S/C25H22N6O2/c1-16(12-26)13-28-24-21-10-18(5-4-17(21)6-7-23(24)33-3)22-11-20(8-9-27-22)30-25(32)19-14-29-31(2)15-19/h4-11,14-15,28H,1,13H2,2-3H3,(H,27,30,32) |
| InChIKey | IDFDPQGQUZRASV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|