C30H36N6O2 — CID 167350018
N-[(1S,2S,4S)-2-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-4-(diethylamino)cyclohexyl]pyrimidine-4-carboxamide (PubChem CID 167350018) has the molecular formula C30H36N6O2 and a molecular weight of 512.66 g/mol. Its IUPAC name is N-[(1S,2S,4S)-2-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-4-(diethylamino)cyclohexyl]pyrimidine-4-carboxamide.
| Compound Name | N-[(1S,2S,4S)-2-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-4-(diethylamino)cyclohexyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 167350018 |
| Molecular Formula | C30H36N6O2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | N-[(1S,2S,4S)-2-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-4-(diethylamino)cyclohexyl]pyrimidine-4-carboxamide |
| SMILES | C=C(C#N)CNc1c(OC)ccc2ccc([C@@H]3C[C@@H](N(CC)CC)CC[C@@H]3NC(=O)c3ccncn3)cc12 |
| InChI | InChI=1S/C30H36N6O2/c1-5-36(6-2)23-10-11-26(35-30(37)27-13-14-32-19-34-27)24(16-23)22-8-7-21-9-12-28(38-4)29(25(21)15-22)33-18-20(3)17-31/h7-9,12-15,19,23-24,26,33H,3,5-6,10-11,16,18H2,1-2,4H3,(H,35,37)/t23-,24-,26-/m0/s1 |
| InChIKey | LSDXOUXTTYIAIP-GNKBHMEESA-N |
| XLogP | 4.91 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|