C29H34N6O2 — CID 167349985
N-[(1S,2S,4S)-2-[8-(2-cyanoprop-2-enylamino)-7-ethoxynaphthalen-2-yl]-4-(dimethylamino)cyclohexyl]pyrimidine-4-carboxamide (PubChem CID 167349985) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is N-[(1S,2S,4S)-2-[8-(2-cyanoprop-2-enylamino)-7-ethoxynaphthalen-2-yl]-4-(dimethylamino)cyclohexyl]pyrimidine-4-carboxamide.
| Compound Name | N-[(1S,2S,4S)-2-[8-(2-cyanoprop-2-enylamino)-7-ethoxynaphthalen-2-yl]-4-(dimethylamino)cyclohexyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 167349985 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | N-[(1S,2S,4S)-2-[8-(2-cyanoprop-2-enylamino)-7-ethoxynaphthalen-2-yl]-4-(dimethylamino)cyclohexyl]pyrimidine-4-carboxamide |
| SMILES | C=C(C#N)CNc1c(OCC)ccc2ccc([C@@H]3C[C@@H](N(C)C)CC[C@@H]3NC(=O)c3ccncn3)cc12 |
| InChI | InChI=1S/C29H34N6O2/c1-5-37-27-11-8-20-6-7-21(14-24(20)28(27)32-17-19(2)16-30)23-15-22(35(3)4)9-10-25(23)34-29(36)26-12-13-31-18-33-26/h6-8,11-14,18,22-23,25,32H,2,5,9-10,15,17H2,1,3-4H3,(H,34,36)/t22-,23-,25-/m0/s1 |
| InChIKey | VRBZRWIJLOZTKY-LSQMVHIFSA-N |
| XLogP | 4.52 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|