C28H32N6O2 — CID 162528122
2-[8-(2-cyanoprop-2-enylamino)-7-propan-2-yloxynaphthalen-2-yl]-N-(1-methylpiperidin-4-yl)pyrimidine-4-carboxamide (PubChem CID 162528122) has the molecular formula C28H32N6O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[8-(2-cyanoprop-2-enylamino)-7-propan-2-yloxynaphthalen-2-yl]-N-(1-methylpiperidin-4-yl)pyrimidine-4-carboxamide.
| Compound Name | 2-[8-(2-cyanoprop-2-enylamino)-7-propan-2-yloxynaphthalen-2-yl]-N-(1-methylpiperidin-4-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 162528122 |
| Molecular Formula | C28H32N6O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 2-[8-(2-cyanoprop-2-enylamino)-7-propan-2-yloxynaphthalen-2-yl]-N-(1-methylpiperidin-4-yl)pyrimidine-4-carboxamide |
| SMILES | C=C(C#N)CNc1c(OC(C)C)ccc2ccc(-c3nccc(C(=O)NC4CCN(C)CC4)n3)cc12 |
| InChI | InChI=1S/C28H32N6O2/c1-18(2)36-25-8-7-20-5-6-21(15-23(20)26(25)31-17-19(3)16-29)27-30-12-9-24(33-27)28(35)32-22-10-13-34(4)14-11-22/h5-9,12,15,18,22,31H,3,10-11,13-14,17H2,1-2,4H3,(H,32,35) |
| InChIKey | QKMKPDCUFIMLMT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|