C26H32N6O2 — CID 162526702
N-[6-(4-formylpyrimidin-2-yl)quinolin-4-yl]prop-2-enamide;1-N,4-N,4-N-trimethylcyclohexane-1,4-diamine (PubChem CID 162526702) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[6-(4-formylpyrimidin-2-yl)quinolin-4-yl]prop-2-enamide;1-N,4-N,4-N-trimethylcyclohexane-1,4-diamine.
| Compound Name | N-[6-(4-formylpyrimidin-2-yl)quinolin-4-yl]prop-2-enamide;1-N,4-N,4-N-trimethylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 162526702 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | N-[6-(4-formylpyrimidin-2-yl)quinolin-4-yl]prop-2-enamide;1-N,4-N,4-N-trimethylcyclohexane-1,4-diamine |
| SMILES | C=CC(=O)Nc1ccnc2ccc(-c3nccc(C=O)n3)cc12.CNC1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C17H12N4O2.C9H20N2/c1-2-16(23)21-15-6-8-18-14-4-3-11(9-13(14)15)17-19-7-5-12(10-22)20-17;1-10-8-4-6-9(7-5-8)11(2)3/h2-10H,1H2,(H,18,21,23);8-10H,4-7H2,1-3H3 |
| InChIKey | IJANKPLKHHZATR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|