C26H18ClN5O2 — CID 162528711
(E)-2-[4-amino-7-(1-methylindazol-6-yl)-3-oxo-1H-isoindole-2-carbonyl]-3-(4-chlorophenyl)prop-2-enenitrile (PubChem CID 162528711) has the molecular formula C26H18ClN5O2 and a molecular weight of 467.92 g/mol. Its IUPAC name is (E)-2-[4-amino-7-(1-methylindazol-6-yl)-3-oxo-1H-isoindole-2-carbonyl]-3-(4-chlorophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-amino-7-(1-methylindazol-6-yl)-3-oxo-1H-isoindole-2-carbonyl]-3-(4-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 162528711 |
| Molecular Formula | C26H18ClN5O2 |
| Molecular Weight | 467.92 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (E)-2-[4-amino-7-(1-methylindazol-6-yl)-3-oxo-1H-isoindole-2-carbonyl]-3-(4-chlorophenyl)prop-2-enenitrile |
| SMILES | Cn1ncc2ccc(-c3ccc(N)c4c3CN(C(=O)/C(C#N)=C/c3ccc(Cl)cc3)C4=O)cc21 |
| InChI | InChI=1S/C26H18ClN5O2/c1-31-23-11-16(4-5-17(23)13-30-31)20-8-9-22(29)24-21(20)14-32(26(24)34)25(33)18(12-28)10-15-2-6-19(27)7-3-15/h2-11,13H,14,29H2,1H3/b18-10+ |
| InChIKey | RNCSSQFFWVRDAP-VCHYOVAHSA-N |
| XLogP | 4.57 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.92 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|