C14H20N4O — CID 162529572
(1S)-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentane-1,5-diamine (PubChem CID 162529572) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is (1S)-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentane-1,5-diamine.
| Compound Name | (1S)-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 162529572 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (1S)-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentane-1,5-diamine |
| SMILES | NCCCC[C@H](N)c1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C14H20N4O/c15-9-5-4-8-12(16)14-17-13(18-19-14)10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15-16H2/t12-/m0/s1 |
| InChIKey | GHKLHUNTMHFITK-LBPRGKRZSA-N |
| XLogP | 1.79 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|