C15H20N4O3 — CID 138689051
[(5S)-5-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]carbamic acid (PubChem CID 138689051) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is [(5S)-5-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]carbamic acid.
| Compound Name | [(5S)-5-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]carbamic acid |
|---|---|
| PubChem CID | 138689051 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | [(5S)-5-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]carbamic acid |
| SMILES | N[C@@H](CCCCNC(=O)O)c1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C15H20N4O3/c16-12(8-4-5-9-17-15(20)21)14-18-13(19-22-14)10-11-6-2-1-3-7-11/h1-3,6-7,12,17H,4-5,8-10,16H2,(H,20,21)/t12-/m0/s1 |
| InChIKey | XASAHUIQVGGIKL-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|