C33H31FN4O5 — CID 162531163
2-[2-fluoro-5-methoxy-3,4-bis(phenylmethoxy)phenyl]-3-(3-methyloxetan-3-yl)benzimidazole-5-carbohydrazide (PubChem CID 162531163) has the molecular formula C33H31FN4O5 and a molecular weight of 582.63 g/mol. Its IUPAC name is 2-[2-fluoro-5-methoxy-3,4-bis(phenylmethoxy)phenyl]-3-(3-methyloxetan-3-yl)benzimidazole-5-carbohydrazide.
| Compound Name | 2-[2-fluoro-5-methoxy-3,4-bis(phenylmethoxy)phenyl]-3-(3-methyloxetan-3-yl)benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 162531163 |
| Molecular Formula | C33H31FN4O5 |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | 2-[2-fluoro-5-methoxy-3,4-bis(phenylmethoxy)phenyl]-3-(3-methyloxetan-3-yl)benzimidazole-5-carbohydrazide |
| SMILES | COc1cc(-c2nc3ccc(C(=O)NN)cc3n2C2(C)COC2)c(F)c(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C33H31FN4O5/c1-33(19-41-20-33)38-26-15-23(32(39)37-35)13-14-25(26)36-31(38)24-16-27(40-2)29(42-17-21-9-5-3-6-10-21)30(28(24)34)43-18-22-11-7-4-8-12-22/h3-16H,17-20,35H2,1-2H3,(H,37,39) |
| InChIKey | OMJUTDYTPAKDOA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|