C19H18F2N2O4 — CID 170036420
3-(difluoromethoxy)-6-methyl-4-[1-(3-methyloxetan-3-yl)benzimidazol-2-yl]benzene-1,2-diol (PubChem CID 170036420) has the molecular formula C19H18F2N2O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is 3-(difluoromethoxy)-6-methyl-4-[1-(3-methyloxetan-3-yl)benzimidazol-2-yl]benzene-1,2-diol.
| Compound Name | 3-(difluoromethoxy)-6-methyl-4-[1-(3-methyloxetan-3-yl)benzimidazol-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 170036420 |
| Molecular Formula | C19H18F2N2O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 3-(difluoromethoxy)-6-methyl-4-[1-(3-methyloxetan-3-yl)benzimidazol-2-yl]benzene-1,2-diol |
| SMILES | Cc1cc(-c2nc3ccccc3n2C2(C)COC2)c(OC(F)F)c(O)c1O |
| InChI | InChI=1S/C19H18F2N2O4/c1-10-7-11(16(27-18(20)21)15(25)14(10)24)17-22-12-5-3-4-6-13(12)23(17)19(2)8-26-9-19/h3-7,18,24-25H,8-9H2,1-2H3 |
| InChIKey | BLQJXFUMJSOZHA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|