C25H26F3N3O5 — CID 162530836
N-(4,4-difluorocyclohexyl)-2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)benzimidazole-5-carboxamide (PubChem CID 162530836) has the molecular formula C25H26F3N3O5 and a molecular weight of 505.49 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)benzimidazole-5-carboxamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 162530836 |
| Molecular Formula | C25H26F3N3O5 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)benzimidazole-5-carboxamide |
| SMILES | COc1cc(-c2nc3ccc(C(=O)NC4CCC(F)(F)CC4)cc3n2C2(C)COC2)c(F)c(O)c1O |
| InChI | InChI=1S/C25H26F3N3O5/c1-24(11-36-12-24)31-17-9-13(23(34)29-14-5-7-25(27,28)8-6-14)3-4-16(17)30-22(31)15-10-18(35-2)20(32)21(33)19(15)26/h3-4,9-10,14,32-33H,5-8,11-12H2,1-2H3,(H,29,34) |
| InChIKey | DWOVQWCQBNHRDL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|