C21H20FN3O6 — CID 168854482
3-[2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-1-(3-methyloxetan-3-yl)benzimidazol-5-yl]-1,3-oxazolidin-2-one (PubChem CID 168854482) has the molecular formula C21H20FN3O6 and a molecular weight of 429.40 g/mol. Its IUPAC name is 3-[2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-1-(3-methyloxetan-3-yl)benzimidazol-5-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-1-(3-methyloxetan-3-yl)benzimidazol-5-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 168854482 |
| Molecular Formula | C21H20FN3O6 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 3-[2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-1-(3-methyloxetan-3-yl)benzimidazol-5-yl]-1,3-oxazolidin-2-one |
| SMILES | COc1cc(-c2nc3cc(N4CCOC4=O)ccc3n2C2(C)COC2)c(F)c(O)c1O |
| InChI | InChI=1S/C21H20FN3O6/c1-21(9-30-10-21)25-14-4-3-11(24-5-6-31-20(24)28)7-13(14)23-19(25)12-8-15(29-2)17(26)18(27)16(12)22/h3-4,7-8,26-27H,5-6,9-10H2,1-2H3 |
| InChIKey | LUNJGAOTTOSHNB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|