C20H22FN3O3 — CID 170036486
4-[5-(ethylamino)-1-(3-methyloxetan-3-yl)benzimidazol-2-yl]-3-fluoro-6-methylbenzene-1,2-diol (PubChem CID 170036486) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is 4-[5-(ethylamino)-1-(3-methyloxetan-3-yl)benzimidazol-2-yl]-3-fluoro-6-methylbenzene-1,2-diol.
| Compound Name | 4-[5-(ethylamino)-1-(3-methyloxetan-3-yl)benzimidazol-2-yl]-3-fluoro-6-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 170036486 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4-[5-(ethylamino)-1-(3-methyloxetan-3-yl)benzimidazol-2-yl]-3-fluoro-6-methylbenzene-1,2-diol |
| SMILES | CCNc1ccc2c(c1)nc(-c1cc(C)c(O)c(O)c1F)n2C1(C)COC1 |
| InChI | InChI=1S/C20H22FN3O3/c1-4-22-12-5-6-15-14(8-12)23-19(24(15)20(3)9-27-10-20)13-7-11(2)17(25)18(26)16(13)21/h5-8,22,25-26H,4,9-10H2,1-3H3 |
| InChIKey | VYZNBPMDFCAWCY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|