C25H24FN3O3 — CID 170036476
4-[5-(benzylamino)-1-(3-methyloxetan-3-yl)benzimidazol-2-yl]-3-fluoro-6-methylbenzene-1,2-diol (PubChem CID 170036476) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 4-[5-(benzylamino)-1-(3-methyloxetan-3-yl)benzimidazol-2-yl]-3-fluoro-6-methylbenzene-1,2-diol.
| Compound Name | 4-[5-(benzylamino)-1-(3-methyloxetan-3-yl)benzimidazol-2-yl]-3-fluoro-6-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 170036476 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-[5-(benzylamino)-1-(3-methyloxetan-3-yl)benzimidazol-2-yl]-3-fluoro-6-methylbenzene-1,2-diol |
| SMILES | Cc1cc(-c2nc3cc(NCc4ccccc4)ccc3n2C2(C)COC2)c(F)c(O)c1O |
| InChI | InChI=1S/C25H24FN3O3/c1-15-10-18(21(26)23(31)22(15)30)24-28-19-11-17(27-12-16-6-4-3-5-7-16)8-9-20(19)29(24)25(2)13-32-14-25/h3-11,27,30-31H,12-14H2,1-2H3 |
| InChIKey | BNIVTNHRIWFTIZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|