C24H27FN4O5 — CID 162530932
2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)-N-(1-methylpyrrolidin-3-yl)benzimidazole-5-carboxamide (PubChem CID 162530932) has the molecular formula C24H27FN4O5 and a molecular weight of 470.50 g/mol. Its IUPAC name is 2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)-N-(1-methylpyrrolidin-3-yl)benzimidazole-5-carboxamide.
| Compound Name | 2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)-N-(1-methylpyrrolidin-3-yl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 162530932 |
| Molecular Formula | C24H27FN4O5 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2-(2-fluoro-3,4-dihydroxy-5-methoxyphenyl)-3-(3-methyloxetan-3-yl)-N-(1-methylpyrrolidin-3-yl)benzimidazole-5-carboxamide |
| SMILES | COc1cc(-c2nc3ccc(C(=O)NC4CCN(C)C4)cc3n2C2(C)COC2)c(F)c(O)c1O |
| InChI | InChI=1S/C24H27FN4O5/c1-24(11-34-12-24)29-17-8-13(23(32)26-14-6-7-28(2)10-14)4-5-16(17)27-22(29)15-9-18(33-3)20(30)21(31)19(15)25/h4-5,8-9,14,30-31H,6-7,10-12H2,1-3H3,(H,26,32) |
| InChIKey | HDAQNDJFKLQCRU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|