C17H21F3N2O2 — CID 162533422
4-[(3R)-3-methylmorpholin-4-yl]-6-[2-(trifluoromethyl)phenyl]piperidin-2-one (PubChem CID 162533422) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 4-[(3R)-3-methylmorpholin-4-yl]-6-[2-(trifluoromethyl)phenyl]piperidin-2-one.
| Compound Name | 4-[(3R)-3-methylmorpholin-4-yl]-6-[2-(trifluoromethyl)phenyl]piperidin-2-one |
|---|---|
| PubChem CID | 162533422 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 4-[(3R)-3-methylmorpholin-4-yl]-6-[2-(trifluoromethyl)phenyl]piperidin-2-one |
| SMILES | C[C@@H]1COCCN1C1CC(=O)NC(c2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H21F3N2O2/c1-11-10-24-7-6-22(11)12-8-15(21-16(23)9-12)13-4-2-3-5-14(13)17(18,19)20/h2-5,11-12,15H,6-10H2,1H3,(H,21,23)/t11-,12?,15?/m1/s1 |
| InChIKey | KKZFHRFZBVWBTA-XIKARTHZSA-N |
| XLogP | 2.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |