C17H15F3N2O6 — CID 162535158
4-nitro-3-(trifluoromethyl)benzamide;3-phenoxypropanoic acid (PubChem CID 162535158) has the molecular formula C17H15F3N2O6 and a molecular weight of 400.31 g/mol. Its IUPAC name is 4-nitro-3-(trifluoromethyl)benzamide;3-phenoxypropanoic acid.
| Compound Name | 4-nitro-3-(trifluoromethyl)benzamide;3-phenoxypropanoic acid |
|---|---|
| PubChem CID | 162535158 |
| Molecular Formula | C17H15F3N2O6 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-nitro-3-(trifluoromethyl)benzamide;3-phenoxypropanoic acid |
| SMILES | NC(=O)c1ccc([N+](=O)[O-])c(C(F)(F)F)c1.O=C(O)CCOc1ccccc1 |
| InChI | InChI=1S/C9H10O3.C8H5F3N2O3/c10-9(11)6-7-12-8-4-2-1-3-5-8;9-8(10,11)5-3-4(7(12)14)1-2-6(5)13(15)16/h1-5H,6-7H2,(H,10,11);1-3H,(H2,12,14) |
| InChIKey | OTGARZDXBGXIAY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|