C14H7F9O3S — CID 162537341
azulen-1-yl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 162537341) has the molecular formula C14H7F9O3S and a molecular weight of 426.26 g/mol. Its IUPAC name is azulen-1-yl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | azulen-1-yl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 162537341 |
| Molecular Formula | C14H7F9O3S |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | azulen-1-yl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(Oc1ccc2cccccc1-2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H7F9O3S/c15-11(16,13(19,20)21)12(17,18)14(22,23)27(24,25)26-10-7-6-8-4-2-1-3-5-9(8)10/h1-7H |
| InChIKey | SJEXRXYMUCXQGH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|