About 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium
1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium (PubChem CID 162539384) has the molecular formula C21H12F6N2O
and a molecular weight of 422.33 g/mol. Its IUPAC name is 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium.
Molecular Properties
| Compound Name | 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium |
| PubChem CID | 162539384 |
| Molecular Formula | C21H12F6N2O |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium |
| SMILES | [O-][n+]1c(-c2ccc(C(F)(F)F)cc2)c(-c2ccc(C(F)(F)F)cc2)n2ccccc21 |
| InChI | InChI=1S/C21H12F6N2O/c22-20(23,24)15-8-4-13(5-9-15)18-19(29(30)17-3-1-2-12-28(17)18)14-6-10-16(11-7-14)21(25,26)27/h1-12H |
| InChIKey | JKJBMSWQZLVXPB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium?
The IUPAC name of 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium (CID 162539384) is 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium.
What is the SMILES notation for 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium?
The canonical SMILES for 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium is [O-][n+]1c(-c2ccc(C(F)(F)F)cc2)c(-c2ccc(C(F)(F)F)cc2)n2ccccc21.
What is the InChIKey of 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium?
The InChIKey is JKJBMSWQZLVXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12F6N2O/c22-20(23,24)15-8-4-13(5-9-15)18-19(29(30)17-3-1-2-12-28(17)18)14-6-10-16(11-7-14)21(25,26)27/h1-12H.
What are the key properties of 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium?
1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium has a molecular weight of 422.33 g/mol, XLogP of 5.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxido-2,3-bis[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-1-ium is sourced from PubChem (CID 162539384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).