C14H8BrF3N2 — CID 172515069
3-bromo-1-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine (PubChem CID 172515069) has the molecular formula C14H8BrF3N2 and a molecular weight of 341.13 g/mol. Its IUPAC name is 3-bromo-1-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine.
| Compound Name | 3-bromo-1-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 172515069 |
| Molecular Formula | C14H8BrF3N2 |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 3-bromo-1-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine |
| SMILES | FC(F)(F)c1ccc(-c2nc(Br)n3ccccc23)cc1 |
| InChI | InChI=1S/C14H8BrF3N2/c15-13-19-12(11-3-1-2-8-20(11)13)9-4-6-10(7-5-9)14(16,17)18/h1-8H |
| InChIKey | GWVDMRRMYOMORN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |