C4H3BrF4Zn — CID 162540262
zinc;3,3,4,4-tetrafluorobut-1-ene;bromide (PubChem CID 162540262) has the molecular formula C4H3BrF4Zn and a molecular weight of 272.35 g/mol. Its IUPAC name is zinc;3,3,4,4-tetrafluorobut-1-ene;bromide.
| Compound Name | zinc;3,3,4,4-tetrafluorobut-1-ene;bromide |
|---|---|
| PubChem CID | 162540262 |
| Molecular Formula | C4H3BrF4Zn |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 269.86 |
| IUPAC Name | zinc;3,3,4,4-tetrafluorobut-1-ene;bromide |
| SMILES | C=CC(F)(F)[C-](F)F.[Br-].[Zn+2] |
| InChI | InChI=1S/C4H3F4.BrH.Zn/c1-2-4(7,8)3(5)6;;/h2H,1H2;1H;/q-1;;+2/p-1 |
| InChIKey | MDFUEYFUGPREJU-UHFFFAOYSA-M |
| XLogP | -0.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|