C5H4F6OY — CID 59893076
1,1,1-trifluoro-2-(trifluoromethyl)but-3-en-2-ol;yttrium (PubChem CID 59893076) has the molecular formula C5H4F6OY and a molecular weight of 282.98 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(trifluoromethyl)but-3-en-2-ol;yttrium.
| Compound Name | 1,1,1-trifluoro-2-(trifluoromethyl)but-3-en-2-ol;yttrium |
|---|---|
| PubChem CID | 59893076 |
| Molecular Formula | C5H4F6OY |
| Molecular Weight | 282.98 g/mol |
| Exact Mass | 282.92 |
| IUPAC Name | 1,1,1-trifluoro-2-(trifluoromethyl)but-3-en-2-ol;yttrium |
| SMILES | C=CC(O)(C(F)(F)F)C(F)(F)F.[Y] |
| InChI | InChI=1S/C5H4F6O.Y/c1-2-3(12,4(6,7)8)5(9,10)11;/h2,12H,1H2; |
| InChIKey | HPIIVICENWHYGV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.98 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|