C14H15F3N3O3S+ — CID 162540870
1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-3-(1-methyl-1,3-thiazol-1-ium-2-yl)urea (PubChem CID 162540870) has the molecular formula C14H15F3N3O3S+ and a molecular weight of 362.35 g/mol. Its IUPAC name is 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-3-(1-methyl-1,3-thiazol-1-ium-2-yl)urea.
| Compound Name | 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-3-(1-methyl-1,3-thiazol-1-ium-2-yl)urea |
|---|---|
| PubChem CID | 162540870 |
| Molecular Formula | C14H15F3N3O3S+ |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]-3-(1-methyl-1,3-thiazol-1-ium-2-yl)urea |
| SMILES | COc1cc(OC)c(C(F)(F)F)cc1NC(=O)Nc1ncc[s+]1C |
| InChI | InChI=1S/C14H14F3N3O3S/c1-22-10-7-11(23-2)9(6-8(10)14(15,16)17)19-12(21)20-13-18-4-5-24(13)3/h4-7H,1-3H3,(H-,18,19,20,21)/p+1 |
| InChIKey | KFFNCBJCOHZYQA-UHFFFAOYSA-O |
| XLogP | 4.05 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|