C35H33F3N2O6S2 — CID 162541020
[4-[(2-methylpropan-2-yl)oxy]phenyl]-bis[2-(pyridin-4-ylmethoxy)phenyl]sulfanium;trifluoromethanesulfonate (PubChem CID 162541020) has the molecular formula C35H33F3N2O6S2 and a molecular weight of 698.79 g/mol. Its IUPAC name is [4-[(2-methylpropan-2-yl)oxy]phenyl]-bis[2-(pyridin-4-ylmethoxy)phenyl]sulfanium;trifluoromethanesulfonate.
| Compound Name | [4-[(2-methylpropan-2-yl)oxy]phenyl]-bis[2-(pyridin-4-ylmethoxy)phenyl]sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162541020 |
| Molecular Formula | C35H33F3N2O6S2 |
| Molecular Weight | 698.79 g/mol |
| Exact Mass | 698.17 |
| IUPAC Name | [4-[(2-methylpropan-2-yl)oxy]phenyl]-bis[2-(pyridin-4-ylmethoxy)phenyl]sulfanium;trifluoromethanesulfonate |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccccc2OCc2ccncc2)c2ccccc2OCc2ccncc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C34H33N2O3S.CHF3O3S/c1-34(2,3)39-28-12-14-29(15-13-28)40(32-10-6-4-8-30(32)37-24-26-16-20-35-21-17-26)33-11-7-5-9-31(33)38-25-27-18-22-36-23-19-27;2-1(3,4)8(5,6)7/h4-23H,24-25H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | UQHCIRFMJYYZGE-UHFFFAOYSA-M |
| XLogP | 7.96 |
| TPSA | 110.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.79 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|