C29H31F6N4O5P — CID 162541866
3-[[3-amino-3-imino-2-(methylamino)propanoyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid (PubChem CID 162541866) has the molecular formula C29H31F6N4O5P and a molecular weight of 660.55 g/mol. Its IUPAC name is 3-[[3-amino-3-imino-2-(methylamino)propanoyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[3-amino-3-imino-2-(methylamino)propanoyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162541866 |
| Molecular Formula | C29H31F6N4O5P |
| Molecular Weight | 660.55 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | 3-[[3-amino-3-imino-2-(methylamino)propanoyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C([O-])C(F)(F)F.[H]/N=C(\N)C(NC)C(=O)NCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29N4OP.2C2HF3O2/c1-28-23(24(26)27)25(30)29-18-11-19-31(20-12-5-2-6-13-20,21-14-7-3-8-15-21)22-16-9-4-10-17-22;2*3-2(4,5)1(6)7/h2-10,12-17,23,28H,11,18-19H2,1H3,(H3-,26,27,29,30);2*(H,6,7) |
| InChIKey | SGRGAZMLUWZIRB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 168.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|