C18H14BrF2N2OS+ — CID 162541987
5-[2-(4-bromophenyl)phenyl]-4-(difluoromethyl)-2-methyl-1,3-thiazol-1-ium-1-carboxamide (PubChem CID 162541987) has the molecular formula C18H14BrF2N2OS+ and a molecular weight of 424.29 g/mol. Its IUPAC name is 5-[2-(4-bromophenyl)phenyl]-4-(difluoromethyl)-2-methyl-1,3-thiazol-1-ium-1-carboxamide.
| Compound Name | 5-[2-(4-bromophenyl)phenyl]-4-(difluoromethyl)-2-methyl-1,3-thiazol-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 162541987 |
| Molecular Formula | C18H14BrF2N2OS+ |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | 5-[2-(4-bromophenyl)phenyl]-4-(difluoromethyl)-2-methyl-1,3-thiazol-1-ium-1-carboxamide |
| SMILES | Cc1nc(C(F)F)c(-c2ccccc2-c2ccc(Br)cc2)[s+]1C(N)=O |
| InChI | InChI=1S/C18H13BrF2N2OS/c1-10-23-15(17(20)21)16(25(10)18(22)24)14-5-3-2-4-13(14)11-6-8-12(19)9-7-11/h2-9,17H,1H3,(H-,22,24)/p+1 |
| InChIKey | PZCOWJNLDWJCOD-UHFFFAOYSA-O |
| XLogP | 6.10 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|