C21H17F2N3O — CID 66728277
3-(difluoromethyl)-1-methyl-5-[2-(4-prop-1-ynylphenyl)phenyl]pyrazole-4-carboxamide (PubChem CID 66728277) has the molecular formula C21H17F2N3O and a molecular weight of 365.38 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-methyl-5-[2-(4-prop-1-ynylphenyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 3-(difluoromethyl)-1-methyl-5-[2-(4-prop-1-ynylphenyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 66728277 |
| Molecular Formula | C21H17F2N3O |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 3-(difluoromethyl)-1-methyl-5-[2-(4-prop-1-ynylphenyl)phenyl]pyrazole-4-carboxamide |
| SMILES | CC#Cc1ccc(-c2ccccc2-c2c(C(N)=O)c(C(F)F)nn2C)cc1 |
| InChI | InChI=1S/C21H17F2N3O/c1-3-6-13-9-11-14(12-10-13)15-7-4-5-8-16(15)19-17(21(24)27)18(20(22)23)25-26(19)2/h4-5,7-12,20H,1-2H3,(H2,24,27) |
| InChIKey | VXBCNERGPXLYTK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|